C37H33ClFN5O4S — CID 166345999
1-[4-(2-chlorophenyl)-1-methyl-1,3,4,9-tetrahydropyrido[3,4-b]indol-2-yl]-2-[[4-(2-fluorophenyl)-5-(3,4,5-trimethoxyphenyl)-1,2,4-triazol-3-yl]sulfanyl]ethanone (PubChem CID 166345999) has the molecular formula C37H33ClFN5O4S and a molecular weight of 698.22 g/mol. Its IUPAC name is 1-[4-(2-chlorophenyl)-1-methyl-1,3,4,9-tetrahydropyrido[3,4-b]indol-2-yl]-2-[[4-(2-fluorophenyl)-5-(3,4,5-trimethoxyphenyl)-1,2,4-triazol-3-yl]sulfanyl]ethanone.
| Compound Name | 1-[4-(2-chlorophenyl)-1-methyl-1,3,4,9-tetrahydropyrido[3,4-b]indol-2-yl]-2-[[4-(2-fluorophenyl)-5-(3,4,5-trimethoxyphenyl)-1,2,4-triazol-3-yl]sulfanyl]ethanone |
|---|---|
| PubChem CID | 166345999 |
| Molecular Formula | C37H33ClFN5O4S |
| Molecular Weight | 698.22 g/mol |
| Exact Mass | 697.19 |
| IUPAC Name | 1-[4-(2-chlorophenyl)-1-methyl-1,3,4,9-tetrahydropyrido[3,4-b]indol-2-yl]-2-[[4-(2-fluorophenyl)-5-(3,4,5-trimethoxyphenyl)-1,2,4-triazol-3-yl]sulfanyl]ethanone |
| SMILES | COc1cc(-c2nnc(SCC(=O)N3CC(c4ccccc4Cl)c4c([nH]c5ccccc45)C3C)n2-c2ccccc2F)cc(OC)c1OC |
| InChI | InChI=1S/C37H33ClFN5O4S/c1-21-34-33(24-12-6-9-15-28(24)40-34)25(23-11-5-7-13-26(23)38)19-43(21)32(45)20-49-37-42-41-36(44(37)29-16-10-8-14-27(29)39)22-17-30(46-2)35(48-4)31(18-22)47-3/h5-18,21,25,40H,19-20H2,1-4H3 |
| InChIKey | PVJGIJIYFVLTIW-UHFFFAOYSA-N |
| XLogP | 8.06 |
| TPSA | 94.50 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 49 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 698.22 |
| LogP ≤ 5 | 8.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'} |
|---|