C29H31Cl3N6O2 — CID 166347081
1-butyl-3-[3-[2-methyl-4-[1-(2,4,5-trichlorophenyl)triazol-4-yl]piperidin-1-yl]-3-oxopropyl]quinoxalin-2-one (PubChem CID 166347081) has the molecular formula C29H31Cl3N6O2 and a molecular weight of 601.97 g/mol. Its IUPAC name is 1-butyl-3-[3-[2-methyl-4-[1-(2,4,5-trichlorophenyl)triazol-4-yl]piperidin-1-yl]-3-oxopropyl]quinoxalin-2-one.
| Compound Name | 1-butyl-3-[3-[2-methyl-4-[1-(2,4,5-trichlorophenyl)triazol-4-yl]piperidin-1-yl]-3-oxopropyl]quinoxalin-2-one |
|---|---|
| PubChem CID | 166347081 |
| Molecular Formula | C29H31Cl3N6O2 |
| Molecular Weight | 601.97 g/mol |
| Exact Mass | 600.16 |
| IUPAC Name | 1-butyl-3-[3-[2-methyl-4-[1-(2,4,5-trichlorophenyl)triazol-4-yl]piperidin-1-yl]-3-oxopropyl]quinoxalin-2-one |
| SMILES | CCCCn1c(=O)c(CCC(=O)N2CCC(c3cn(-c4cc(Cl)c(Cl)cc4Cl)nn3)CC2C)nc2ccccc21 |
| InChI | InChI=1S/C29H31Cl3N6O2/c1-3-4-12-37-26-8-6-5-7-23(26)33-24(29(37)40)9-10-28(39)36-13-11-19(14-18(36)2)25-17-38(35-34-25)27-16-21(31)20(30)15-22(27)32/h5-8,15-19H,3-4,9-14H2,1-2H3 |
| InChIKey | RQYXPIUKILQOFG-UHFFFAOYSA-N |
| XLogP | 6.46 |
| TPSA | 85.91 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 601.97 |
| LogP ≤ 5 | 6.46 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|