C19H19N5O2 — CID 166349219
N-[2-(benzylamino)-2-oxoethyl]-2-(1,7-naphthyridin-4-ylamino)acetamide (PubChem CID 166349219) has the molecular formula C19H19N5O2 and a molecular weight of 349.39 g/mol. Its IUPAC name is N-[2-(benzylamino)-2-oxoethyl]-2-(1,7-naphthyridin-4-ylamino)acetamide.
| Compound Name | N-[2-(benzylamino)-2-oxoethyl]-2-(1,7-naphthyridin-4-ylamino)acetamide |
|---|---|
| PubChem CID | 166349219 |
| Molecular Formula | C19H19N5O2 |
| Molecular Weight | 349.39 g/mol |
| Exact Mass | 349.15 |
| IUPAC Name | N-[2-(benzylamino)-2-oxoethyl]-2-(1,7-naphthyridin-4-ylamino)acetamide |
| SMILES | O=C(CNC(=O)CNc1ccnc2cnccc12)NCc1ccccc1 |
| InChI | InChI=1S/C19H19N5O2/c25-18(24-13-19(26)23-10-14-4-2-1-3-5-14)12-22-16-7-9-21-17-11-20-8-6-15(16)17/h1-9,11H,10,12-13H2,(H,21,22)(H,23,26)(H,24,25) |
| InChIKey | XCDNHRGASJPIFQ-UHFFFAOYSA-N |
| XLogP | 1.47 |
| TPSA | 96.01 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 349.39 |
| LogP ≤ 5 | 1.47 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |