C12H18N2O4S — CID 166350644
N-[(1R,2S,3R,4R)-2,3-dihydroxy-4-(hydroxymethyl)cyclopentyl]-2-(5-methyl-1,3-thiazol-2-yl)acetamide (PubChem CID 166350644) has the molecular formula C12H18N2O4S and a molecular weight of 286.35 g/mol. Its IUPAC name is N-[(1R,2S,3R,4R)-2,3-dihydroxy-4-(hydroxymethyl)cyclopentyl]-2-(5-methyl-1,3-thiazol-2-yl)acetamide.
| Compound Name | N-[(1R,2S,3R,4R)-2,3-dihydroxy-4-(hydroxymethyl)cyclopentyl]-2-(5-methyl-1,3-thiazol-2-yl)acetamide |
|---|---|
| PubChem CID | 166350644 |
| Molecular Formula | C12H18N2O4S |
| Molecular Weight | 286.35 g/mol |
| Exact Mass | 286.10 |
| IUPAC Name | N-[(1R,2S,3R,4R)-2,3-dihydroxy-4-(hydroxymethyl)cyclopentyl]-2-(5-methyl-1,3-thiazol-2-yl)acetamide |
| SMILES | Cc1cnc(CC(=O)N[C@@H]2C[C@H](CO)[C@@H](O)[C@H]2O)s1 |
| InChI | InChI=1S/C12H18N2O4S/c1-6-4-13-10(19-6)3-9(16)14-8-2-7(5-15)11(17)12(8)18/h4,7-8,11-12,15,17-18H,2-3,5H2,1H3,(H,14,16)/t7-,8-,11-,12+/m1/s1 |
| InChIKey | VXGSJLOQBKJPSV-VNOQCFOKSA-N |
| XLogP | -0.79 |
| TPSA | 102.68 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 286.35 |
| LogP ≤ 5 | -0.79 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |