C28H24BrF2N7O2 — CID 166352511
[3-[4-(2-amino-4-bromo-3,5-difluorophenyl)triazol-1-yl]pyrrolidin-1-yl]-[2-[(8-methylimidazo[1,2-a]pyridin-2-yl)methoxy]phenyl]methanone (PubChem CID 166352511) has the molecular formula C28H24BrF2N7O2 and a molecular weight of 608.45 g/mol. Its IUPAC name is [3-[4-(2-amino-4-bromo-3,5-difluorophenyl)triazol-1-yl]pyrrolidin-1-yl]-[2-[(8-methylimidazo[1,2-a]pyridin-2-yl)methoxy]phenyl]methanone.
| Compound Name | [3-[4-(2-amino-4-bromo-3,5-difluorophenyl)triazol-1-yl]pyrrolidin-1-yl]-[2-[(8-methylimidazo[1,2-a]pyridin-2-yl)methoxy]phenyl]methanone |
|---|---|
| PubChem CID | 166352511 |
| Molecular Formula | C28H24BrF2N7O2 |
| Molecular Weight | 608.45 g/mol |
| Exact Mass | 607.11 |
| IUPAC Name | [3-[4-(2-amino-4-bromo-3,5-difluorophenyl)triazol-1-yl]pyrrolidin-1-yl]-[2-[(8-methylimidazo[1,2-a]pyridin-2-yl)methoxy]phenyl]methanone |
| SMILES | Cc1cccn2cc(COc3ccccc3C(=O)N3CCC(n4cc(-c5cc(F)c(Br)c(F)c5N)nn4)C3)nc12 |
| InChI | InChI=1S/C28H24BrF2N7O2/c1-16-5-4-9-36-12-17(33-27(16)36)15-40-23-7-3-2-6-19(23)28(39)37-10-8-18(13-37)38-14-22(34-35-38)20-11-21(30)24(29)25(31)26(20)32/h2-7,9,11-12,14,18H,8,10,13,15,32H2,1H3 |
| InChIKey | OLQPEOUYVXMNQD-UHFFFAOYSA-N |
| XLogP | 5.19 |
| TPSA | 103.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 608.45 |
| LogP ≤ 5 | 5.19 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|