C24H30N4O4 — CID 166355416
ethyl 3-[[3-[(2,6-dimethylpiperidin-3-yl)carbamoylamino]benzoyl]amino]benzoate (PubChem CID 166355416) has the molecular formula C24H30N4O4 and a molecular weight of 438.53 g/mol. Its IUPAC name is ethyl 3-[[3-[(2,6-dimethylpiperidin-3-yl)carbamoylamino]benzoyl]amino]benzoate.
| Compound Name | ethyl 3-[[3-[(2,6-dimethylpiperidin-3-yl)carbamoylamino]benzoyl]amino]benzoate |
|---|---|
| PubChem CID | 166355416 |
| Molecular Formula | C24H30N4O4 |
| Molecular Weight | 438.53 g/mol |
| Exact Mass | 438.23 |
| IUPAC Name | ethyl 3-[[3-[(2,6-dimethylpiperidin-3-yl)carbamoylamino]benzoyl]amino]benzoate |
| SMILES | CCOC(=O)c1cccc(NC(=O)c2cccc(NC(=O)NC3CCC(C)NC3C)c2)c1 |
| InChI | InChI=1S/C24H30N4O4/c1-4-32-23(30)18-8-6-9-19(14-18)26-22(29)17-7-5-10-20(13-17)27-24(31)28-21-12-11-15(2)25-16(21)3/h5-10,13-16,21,25H,4,11-12H2,1-3H3,(H,26,29)(H2,27,28,31) |
| InChIKey | ORUQGJYMUOZQFL-UHFFFAOYSA-N |
| XLogP | 3.77 |
| TPSA | 108.56 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 438.53 |
| LogP ≤ 5 | 3.77 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |