C23H20N2O3S — CID 166357007
[2-(4-ethoxyphenyl)-1,3-thiazol-4-yl]methyl 2-isoquinolin-6-ylacetate (PubChem CID 166357007) has the molecular formula C23H20N2O3S and a molecular weight of 404.49 g/mol. Its IUPAC name is [2-(4-ethoxyphenyl)-1,3-thiazol-4-yl]methyl 2-isoquinolin-6-ylacetate.
| Compound Name | [2-(4-ethoxyphenyl)-1,3-thiazol-4-yl]methyl 2-isoquinolin-6-ylacetate |
|---|---|
| PubChem CID | 166357007 |
| Molecular Formula | C23H20N2O3S |
| Molecular Weight | 404.49 g/mol |
| Exact Mass | 404.12 |
| IUPAC Name | [2-(4-ethoxyphenyl)-1,3-thiazol-4-yl]methyl 2-isoquinolin-6-ylacetate |
| SMILES | CCOc1ccc(-c2nc(COC(=O)Cc3ccc4cnccc4c3)cs2)cc1 |
| InChI | InChI=1S/C23H20N2O3S/c1-2-27-21-7-5-17(6-8-21)23-25-20(15-29-23)14-28-22(26)12-16-3-4-19-13-24-10-9-18(19)11-16/h3-11,13,15H,2,12,14H2,1H3 |
| InChIKey | ZZCRQRMNSAOILJ-UHFFFAOYSA-N |
| XLogP | 5.04 |
| TPSA | 61.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 404.49 |
| LogP ≤ 5 | 5.04 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |