C10H19N3O4S — CID 166357419
1-[bis(2-methoxyethyl)sulfamoylamino]pyrrole (PubChem CID 166357419) has the molecular formula C10H19N3O4S and a molecular weight of 277.35 g/mol. Its IUPAC name is 1-[bis(2-methoxyethyl)sulfamoylamino]pyrrole.
| Compound Name | 1-[bis(2-methoxyethyl)sulfamoylamino]pyrrole |
|---|---|
| PubChem CID | 166357419 |
| Molecular Formula | C10H19N3O4S |
| Molecular Weight | 277.35 g/mol |
| Exact Mass | 277.11 |
| IUPAC Name | 1-[bis(2-methoxyethyl)sulfamoylamino]pyrrole |
| SMILES | COCCN(CCOC)S(=O)(=O)Nn1cccc1 |
| InChI | InChI=1S/C10H19N3O4S/c1-16-9-7-13(8-10-17-2)18(14,15)11-12-5-3-4-6-12/h3-6,11H,7-10H2,1-2H3 |
| InChIKey | VNEMSCWZWSIRMK-UHFFFAOYSA-N |
| XLogP | -0.13 |
| TPSA | 72.80 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 277.35 |
| LogP ≤ 5 | -0.13 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |