C25H30N4O3 — CID 166357526
tert-butyl 3-[[[4-(oxolan-2-ylmethylamino)quinazolin-2-yl]amino]methyl]benzoate (PubChem CID 166357526) has the molecular formula C25H30N4O3 and a molecular weight of 434.54 g/mol. Its IUPAC name is tert-butyl 3-[[[4-(oxolan-2-ylmethylamino)quinazolin-2-yl]amino]methyl]benzoate.
| Compound Name | tert-butyl 3-[[[4-(oxolan-2-ylmethylamino)quinazolin-2-yl]amino]methyl]benzoate |
|---|---|
| PubChem CID | 166357526 |
| Molecular Formula | C25H30N4O3 |
| Molecular Weight | 434.54 g/mol |
| Exact Mass | 434.23 |
| IUPAC Name | tert-butyl 3-[[[4-(oxolan-2-ylmethylamino)quinazolin-2-yl]amino]methyl]benzoate |
| SMILES | CC(C)(C)OC(=O)c1cccc(CNc2nc(NCC3CCCO3)c3ccccc3n2)c1 |
| InChI | InChI=1S/C25H30N4O3/c1-25(2,3)32-23(30)18-9-6-8-17(14-18)15-27-24-28-21-12-5-4-11-20(21)22(29-24)26-16-19-10-7-13-31-19/h4-6,8-9,11-12,14,19H,7,10,13,15-16H2,1-3H3,(H2,26,27,28,29) |
| InChIKey | MFGBQGVUUCCSTE-UHFFFAOYSA-N |
| XLogP | 4.79 |
| TPSA | 85.37 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 434.54 |
| LogP ≤ 5 | 4.79 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |