C17H15BrN2O2S2 — CID 166357647
N-(4-bromo-2-ethylphenyl)-2-phenyl-1,3-thiazole-5-sulfonamide (PubChem CID 166357647) has the molecular formula C17H15BrN2O2S2 and a molecular weight of 423.36 g/mol. Its IUPAC name is N-(4-bromo-2-ethylphenyl)-2-phenyl-1,3-thiazole-5-sulfonamide.
| Compound Name | N-(4-bromo-2-ethylphenyl)-2-phenyl-1,3-thiazole-5-sulfonamide |
|---|---|
| PubChem CID | 166357647 |
| Molecular Formula | C17H15BrN2O2S2 |
| Molecular Weight | 423.36 g/mol |
| Exact Mass | 421.98 |
| IUPAC Name | N-(4-bromo-2-ethylphenyl)-2-phenyl-1,3-thiazole-5-sulfonamide |
| SMILES | CCc1cc(Br)ccc1NS(=O)(=O)c1cnc(-c2ccccc2)s1 |
| InChI | InChI=1S/C17H15BrN2O2S2/c1-2-12-10-14(18)8-9-15(12)20-24(21,22)16-11-19-17(23-16)13-6-4-3-5-7-13/h3-11,20H,2H2,1H3 |
| InChIKey | IDWVQKXOTLCSKM-UHFFFAOYSA-N |
| XLogP | 4.94 |
| TPSA | 59.06 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 423.36 |
| LogP ≤ 5 | 4.94 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |