C19H23ClN2O3S — CID 166358003
ethyl (2S)-2-[(7-chlorothieno[2,3-c]pyridine-2-carbonyl)amino]-3-cyclohexylpropanoate (PubChem CID 166358003) has the molecular formula C19H23ClN2O3S and a molecular weight of 394.92 g/mol. Its IUPAC name is ethyl (2S)-2-[(7-chlorothieno[2,3-c]pyridine-2-carbonyl)amino]-3-cyclohexylpropanoate.
| Compound Name | ethyl (2S)-2-[(7-chlorothieno[2,3-c]pyridine-2-carbonyl)amino]-3-cyclohexylpropanoate |
|---|---|
| PubChem CID | 166358003 |
| Molecular Formula | C19H23ClN2O3S |
| Molecular Weight | 394.92 g/mol |
| Exact Mass | 394.11 |
| IUPAC Name | ethyl (2S)-2-[(7-chlorothieno[2,3-c]pyridine-2-carbonyl)amino]-3-cyclohexylpropanoate |
| SMILES | CCOC(=O)[C@H](CC1CCCCC1)NC(=O)c1cc2ccnc(Cl)c2s1 |
| InChI | InChI=1S/C19H23ClN2O3S/c1-2-25-19(24)14(10-12-6-4-3-5-7-12)22-18(23)15-11-13-8-9-21-17(20)16(13)26-15/h8-9,11-12,14H,2-7,10H2,1H3,(H,22,23)/t14-/m0/s1 |
| InChIKey | DVKQUTOYGANRKJ-AWEZNQCLSA-N |
| XLogP | 4.58 |
| TPSA | 68.29 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 394.92 |
| LogP ≤ 5 | 4.58 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|