C17H15ClFNO — CID 166359275
N-[(1R,2S)-2-(3-chlorophenyl)cyclopropyl]-2-(3-fluorophenyl)acetamide (PubChem CID 166359275) has the molecular formula C17H15ClFNO and a molecular weight of 303.76 g/mol. Its IUPAC name is N-[(1R,2S)-2-(3-chlorophenyl)cyclopropyl]-2-(3-fluorophenyl)acetamide.
| Compound Name | N-[(1R,2S)-2-(3-chlorophenyl)cyclopropyl]-2-(3-fluorophenyl)acetamide |
|---|---|
| PubChem CID | 166359275 |
| Molecular Formula | C17H15ClFNO |
| Molecular Weight | 303.76 g/mol |
| Exact Mass | 303.08 |
| IUPAC Name | N-[(1R,2S)-2-(3-chlorophenyl)cyclopropyl]-2-(3-fluorophenyl)acetamide |
| SMILES | O=C(Cc1cccc(F)c1)N[C@@H]1C[C@H]1c1cccc(Cl)c1 |
| InChI | InChI=1S/C17H15ClFNO/c18-13-5-2-4-12(9-13)15-10-16(15)20-17(21)8-11-3-1-6-14(19)7-11/h1-7,9,15-16H,8,10H2,(H,20,21)/t15-,16+/m0/s1 |
| InChIKey | UJCMEHFMCOYHAR-JKSUJKDBSA-N |
| XLogP | 3.69 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 303.76 |
| LogP ≤ 5 | 3.69 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |