C11H6F3N3S — CID 166360287
2-(1H-indazol-4-yl)-4-(trifluoromethyl)-1,3-thiazole (PubChem CID 166360287) has the molecular formula C11H6F3N3S and a molecular weight of 269.25 g/mol. Its IUPAC name is 2-(1H-indazol-4-yl)-4-(trifluoromethyl)-1,3-thiazole.
| Compound Name | 2-(1H-indazol-4-yl)-4-(trifluoromethyl)-1,3-thiazole |
|---|---|
| PubChem CID | 166360287 |
| Molecular Formula | C11H6F3N3S |
| Molecular Weight | 269.25 g/mol |
| Exact Mass | 269.02 |
| IUPAC Name | 2-(1H-indazol-4-yl)-4-(trifluoromethyl)-1,3-thiazole |
| SMILES | FC(F)(F)c1csc(-c2cccc3[nH]ncc23)n1 |
| InChI | InChI=1S/C11H6F3N3S/c12-11(13,14)9-5-18-10(16-9)6-2-1-3-8-7(6)4-15-17-8/h1-5H,(H,15,17) |
| InChIKey | CDBPNHYSLDRGFO-UHFFFAOYSA-N |
| XLogP | 3.71 |
| TPSA | 41.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 269.25 |
| LogP ≤ 5 | 3.71 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |