C18H20N4S — CID 166361552
1-[5-(3-methyl-1-benzothiophen-2-yl)pyrazin-2-yl]-1,4-diazepane (PubChem CID 166361552) has the molecular formula C18H20N4S and a molecular weight of 324.45 g/mol. Its IUPAC name is 1-[5-(3-methyl-1-benzothiophen-2-yl)pyrazin-2-yl]-1,4-diazepane.
| Compound Name | 1-[5-(3-methyl-1-benzothiophen-2-yl)pyrazin-2-yl]-1,4-diazepane |
|---|---|
| PubChem CID | 166361552 |
| Molecular Formula | C18H20N4S |
| Molecular Weight | 324.45 g/mol |
| Exact Mass | 324.14 |
| IUPAC Name | 1-[5-(3-methyl-1-benzothiophen-2-yl)pyrazin-2-yl]-1,4-diazepane |
| SMILES | Cc1c(-c2cnc(N3CCCNCC3)cn2)sc2ccccc12 |
| InChI | InChI=1S/C18H20N4S/c1-13-14-5-2-3-6-16(14)23-18(13)15-11-21-17(12-20-15)22-9-4-7-19-8-10-22/h2-3,5-6,11-12,19H,4,7-10H2,1H3 |
| InChIKey | HPHFAMPHOGVLTQ-UHFFFAOYSA-N |
| XLogP | 3.47 |
| TPSA | 41.05 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 324.45 |
| LogP ≤ 5 | 3.47 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |