C16H16N6O — CID 166362454
2-[4-(aminomethyl)triazol-1-yl]-N-(4-phenyl-3-pyridinyl)acetamide (PubChem CID 166362454) has the molecular formula C16H16N6O and a molecular weight of 308.35 g/mol. Its IUPAC name is 2-[4-(aminomethyl)triazol-1-yl]-N-(4-phenyl-3-pyridinyl)acetamide.
| Compound Name | 2-[4-(aminomethyl)triazol-1-yl]-N-(4-phenyl-3-pyridinyl)acetamide |
|---|---|
| PubChem CID | 166362454 |
| Molecular Formula | C16H16N6O |
| Molecular Weight | 308.35 g/mol |
| Exact Mass | 308.14 |
| IUPAC Name | 2-[4-(aminomethyl)triazol-1-yl]-N-(4-phenyl-3-pyridinyl)acetamide |
| SMILES | NCc1cn(CC(=O)Nc2cnccc2-c2ccccc2)nn1 |
| InChI | InChI=1S/C16H16N6O/c17-8-13-10-22(21-20-13)11-16(23)19-15-9-18-7-6-14(15)12-4-2-1-3-5-12/h1-7,9-10H,8,11,17H2,(H,19,23) |
| InChIKey | YUYKZKXWTIUBBN-UHFFFAOYSA-N |
| XLogP | 1.44 |
| TPSA | 98.72 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 308.35 |
| LogP ≤ 5 | 1.44 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |