C23H26N4O2 — CID 166363719
N-(1-benzyl-5,5-dimethylpyrrolidin-3-yl)-3-(2-oxo-1H-imidazol-3-yl)benzamide (PubChem CID 166363719) has the molecular formula C23H26N4O2 and a molecular weight of 390.49 g/mol. Its IUPAC name is N-(1-benzyl-5,5-dimethylpyrrolidin-3-yl)-3-(2-oxo-1H-imidazol-3-yl)benzamide.
| Compound Name | N-(1-benzyl-5,5-dimethylpyrrolidin-3-yl)-3-(2-oxo-1H-imidazol-3-yl)benzamide |
|---|---|
| PubChem CID | 166363719 |
| Molecular Formula | C23H26N4O2 |
| Molecular Weight | 390.49 g/mol |
| Exact Mass | 390.21 |
| IUPAC Name | N-(1-benzyl-5,5-dimethylpyrrolidin-3-yl)-3-(2-oxo-1H-imidazol-3-yl)benzamide |
| SMILES | CC1(C)CC(NC(=O)c2cccc(-n3cc[nH]c3=O)c2)CN1Cc1ccccc1 |
| InChI | InChI=1S/C23H26N4O2/c1-23(2)14-19(16-26(23)15-17-7-4-3-5-8-17)25-21(28)18-9-6-10-20(13-18)27-12-11-24-22(27)29/h3-13,19H,14-16H2,1-2H3,(H,24,29)(H,25,28) |
| InChIKey | DMTNBNCLJHAAAI-UHFFFAOYSA-N |
| XLogP | 2.95 |
| TPSA | 70.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 390.49 |
| LogP ≤ 5 | 2.95 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |