C23H22F3N5O3 — CID 166364471
N-phenyl-6-(1,2,3,4-tetrahydroisoquinolin-3-ylmethylamino)pyridazine-3-carboxamide;2,2,2-trifluoroacetic acid (PubChem CID 166364471) has the molecular formula C23H22F3N5O3 and a molecular weight of 473.46 g/mol. Its IUPAC name is N-phenyl-6-(1,2,3,4-tetrahydroisoquinolin-3-ylmethylamino)pyridazine-3-carboxamide;2,2,2-trifluoroacetic acid.
| Compound Name | N-phenyl-6-(1,2,3,4-tetrahydroisoquinolin-3-ylmethylamino)pyridazine-3-carboxamide;2,2,2-trifluoroacetic acid |
|---|---|
| PubChem CID | 166364471 |
| Molecular Formula | C23H22F3N5O3 |
| Molecular Weight | 473.46 g/mol |
| Exact Mass | 473.17 |
| IUPAC Name | N-phenyl-6-(1,2,3,4-tetrahydroisoquinolin-3-ylmethylamino)pyridazine-3-carboxamide;2,2,2-trifluoroacetic acid |
| SMILES | O=C(Nc1ccccc1)c1ccc(NCC2Cc3ccccc3CN2)nn1.O=C(O)C(F)(F)F |
| InChI | InChI=1S/C21H21N5O.C2HF3O2/c27-21(24-17-8-2-1-3-9-17)19-10-11-20(26-25-19)23-14-18-12-15-6-4-5-7-16(15)13-22-18;3-2(4,5)1(6)7/h1-11,18,22H,12-14H2,(H,23,26)(H,24,27);(H,6,7) |
| InChIKey | YHJJQXALFOJUJY-UHFFFAOYSA-N |
| XLogP | 3.49 |
| TPSA | 116.24 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 473.46 |
| LogP ≤ 5 | 3.49 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |