C18H19FN4 — CID 166365177
2-amino-4-[[1-(2-fluorophenyl)cyclopentyl]methylamino]pyridine-3-carbonitrile (PubChem CID 166365177) has the molecular formula C18H19FN4 and a molecular weight of 310.38 g/mol. Its IUPAC name is 2-amino-4-[[1-(2-fluorophenyl)cyclopentyl]methylamino]pyridine-3-carbonitrile.
| Compound Name | 2-amino-4-[[1-(2-fluorophenyl)cyclopentyl]methylamino]pyridine-3-carbonitrile |
|---|---|
| PubChem CID | 166365177 |
| Molecular Formula | C18H19FN4 |
| Molecular Weight | 310.38 g/mol |
| Exact Mass | 310.16 |
| IUPAC Name | 2-amino-4-[[1-(2-fluorophenyl)cyclopentyl]methylamino]pyridine-3-carbonitrile |
| SMILES | N#Cc1c(NCC2(c3ccccc3F)CCCC2)ccnc1N |
| InChI | InChI=1S/C18H19FN4/c19-15-6-2-1-5-14(15)18(8-3-4-9-18)12-23-16-7-10-22-17(21)13(16)11-20/h1-2,5-7,10H,3-4,8-9,12H2,(H3,21,22,23) |
| InChIKey | MBHIGOGEKKOCHI-UHFFFAOYSA-N |
| XLogP | 3.60 |
| TPSA | 74.73 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 310.38 |
| LogP ≤ 5 | 3.60 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |