C19H28N6O2 — CID 166365699
tert-butyl 4-(benzylamino)-4-(1-methyltetrazol-5-yl)piperidine-1-carboxylate (PubChem CID 166365699) has the molecular formula C19H28N6O2 and a molecular weight of 372.47 g/mol. Its IUPAC name is tert-butyl 4-(benzylamino)-4-(1-methyltetrazol-5-yl)piperidine-1-carboxylate.
| Compound Name | tert-butyl 4-(benzylamino)-4-(1-methyltetrazol-5-yl)piperidine-1-carboxylate |
|---|---|
| PubChem CID | 166365699 |
| Molecular Formula | C19H28N6O2 |
| Molecular Weight | 372.47 g/mol |
| Exact Mass | 372.23 |
| IUPAC Name | tert-butyl 4-(benzylamino)-4-(1-methyltetrazol-5-yl)piperidine-1-carboxylate |
| SMILES | Cn1nnnc1C1(NCc2ccccc2)CCN(C(=O)OC(C)(C)C)CC1 |
| InChI | InChI=1S/C19H28N6O2/c1-18(2,3)27-17(26)25-12-10-19(11-13-25,16-21-22-23-24(16)4)20-14-15-8-6-5-7-9-15/h5-9,20H,10-14H2,1-4H3 |
| InChIKey | SSHVGEYXESFWAG-UHFFFAOYSA-N |
| XLogP | 2.23 |
| TPSA | 85.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 372.47 |
| LogP ≤ 5 | 2.23 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |