C17H16F3N3O — CID 166366227
N-[4-(2,2,2-trifluoroethyl)phenyl]-5,6,7,8-tetrahydro-1,7-naphthyridine-3-carboxamide (PubChem CID 166366227) has the molecular formula C17H16F3N3O and a molecular weight of 335.33 g/mol. Its IUPAC name is N-[4-(2,2,2-trifluoroethyl)phenyl]-5,6,7,8-tetrahydro-1,7-naphthyridine-3-carboxamide.
| Compound Name | N-[4-(2,2,2-trifluoroethyl)phenyl]-5,6,7,8-tetrahydro-1,7-naphthyridine-3-carboxamide |
|---|---|
| PubChem CID | 166366227 |
| Molecular Formula | C17H16F3N3O |
| Molecular Weight | 335.33 g/mol |
| Exact Mass | 335.12 |
| IUPAC Name | N-[4-(2,2,2-trifluoroethyl)phenyl]-5,6,7,8-tetrahydro-1,7-naphthyridine-3-carboxamide |
| SMILES | O=C(Nc1ccc(CC(F)(F)F)cc1)c1cnc2c(c1)CCNC2 |
| InChI | InChI=1S/C17H16F3N3O/c18-17(19,20)8-11-1-3-14(4-2-11)23-16(24)13-7-12-5-6-21-10-15(12)22-9-13/h1-4,7,9,21H,5-6,8,10H2,(H,23,24) |
| InChIKey | QAPYWYNEFMRJQV-UHFFFAOYSA-N |
| XLogP | 3.08 |
| TPSA | 54.02 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 335.33 |
| LogP ≤ 5 | 3.08 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |