C16H27N3O3 — CID 166367740
N-[1-(1-ethyl-6-oxopiperidine-3-carbonyl)azepan-3-yl]acetamide (PubChem CID 166367740) has the molecular formula C16H27N3O3 and a molecular weight of 309.41 g/mol. Its IUPAC name is N-[1-(1-ethyl-6-oxopiperidine-3-carbonyl)azepan-3-yl]acetamide.
| Compound Name | N-[1-(1-ethyl-6-oxopiperidine-3-carbonyl)azepan-3-yl]acetamide |
|---|---|
| PubChem CID | 166367740 |
| Molecular Formula | C16H27N3O3 |
| Molecular Weight | 309.41 g/mol |
| Exact Mass | 309.21 |
| IUPAC Name | N-[1-(1-ethyl-6-oxopiperidine-3-carbonyl)azepan-3-yl]acetamide |
| SMILES | CCN1CC(C(=O)N2CCCCC(NC(C)=O)C2)CCC1=O |
| InChI | InChI=1S/C16H27N3O3/c1-3-18-10-13(7-8-15(18)21)16(22)19-9-5-4-6-14(11-19)17-12(2)20/h13-14H,3-11H2,1-2H3,(H,17,20) |
| InChIKey | JPVHEXVNCBCAAT-UHFFFAOYSA-N |
| XLogP | 0.76 |
| TPSA | 69.72 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 309.41 |
| LogP ≤ 5 | 0.76 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |