C23H33N3O4 — CID 167921294
N-[(3S)-1-(1-ethyl-6-oxopiperidine-3-carbonyl)azepan-3-yl]-4-methoxy-3-methylbenzamide (PubChem CID 167921294) has the molecular formula C23H33N3O4 and a molecular weight of 415.53 g/mol. Its IUPAC name is N-[(3S)-1-(1-ethyl-6-oxopiperidine-3-carbonyl)azepan-3-yl]-4-methoxy-3-methylbenzamide.
| Compound Name | N-[(3S)-1-(1-ethyl-6-oxopiperidine-3-carbonyl)azepan-3-yl]-4-methoxy-3-methylbenzamide |
|---|---|
| PubChem CID | 167921294 |
| Molecular Formula | C23H33N3O4 |
| Molecular Weight | 415.53 g/mol |
| Exact Mass | 415.25 |
| IUPAC Name | N-[(3S)-1-(1-ethyl-6-oxopiperidine-3-carbonyl)azepan-3-yl]-4-methoxy-3-methylbenzamide |
| SMILES | CCN1CC(C(=O)N2CCCC[C@H](NC(=O)c3ccc(OC)c(C)c3)C2)CCC1=O |
| InChI | InChI=1S/C23H33N3O4/c1-4-25-14-18(9-11-21(25)27)23(29)26-12-6-5-7-19(15-26)24-22(28)17-8-10-20(30-3)16(2)13-17/h8,10,13,18-19H,4-7,9,11-12,14-15H2,1-3H3,(H,24,28)/t18?,19-/m0/s1 |
| InChIKey | WUBKYAGKJACOLP-GGYWPGCISA-N |
| XLogP | 2.37 |
| TPSA | 78.95 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 415.53 |
| LogP ≤ 5 | 2.37 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |