C21H19FN2O3 — CID 166367826
5-fluoro-3-N-[2-(4-methoxynaphthalen-1-yl)ethyl]benzene-1,3-dicarboxamide (PubChem CID 166367826) has the molecular formula C21H19FN2O3 and a molecular weight of 366.39 g/mol. Its IUPAC name is 5-fluoro-3-N-[2-(4-methoxynaphthalen-1-yl)ethyl]benzene-1,3-dicarboxamide.
| Compound Name | 5-fluoro-3-N-[2-(4-methoxynaphthalen-1-yl)ethyl]benzene-1,3-dicarboxamide |
|---|---|
| PubChem CID | 166367826 |
| Molecular Formula | C21H19FN2O3 |
| Molecular Weight | 366.39 g/mol |
| Exact Mass | 366.14 |
| IUPAC Name | 5-fluoro-3-N-[2-(4-methoxynaphthalen-1-yl)ethyl]benzene-1,3-dicarboxamide |
| SMILES | COc1ccc(CCNC(=O)c2cc(F)cc(C(N)=O)c2)c2ccccc12 |
| InChI | InChI=1S/C21H19FN2O3/c1-27-19-7-6-13(17-4-2-3-5-18(17)19)8-9-24-21(26)15-10-14(20(23)25)11-16(22)12-15/h2-7,10-12H,8-9H2,1H3,(H2,23,25)(H,24,26) |
| InChIKey | KTFYDXJWYOMCBY-UHFFFAOYSA-N |
| XLogP | 3.06 |
| TPSA | 81.42 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 366.39 |
| LogP ≤ 5 | 3.06 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |