C17H24N4O2S — CID 166368105
1-(5-tert-butyl-1,2-oxazol-3-yl)-3-[(6-methyl-4,5,6,7-tetrahydro-1,3-benzothiazol-2-yl)methyl]urea (PubChem CID 166368105) has the molecular formula C17H24N4O2S and a molecular weight of 348.47 g/mol. Its IUPAC name is 1-(5-tert-butyl-1,2-oxazol-3-yl)-3-[(6-methyl-4,5,6,7-tetrahydro-1,3-benzothiazol-2-yl)methyl]urea.
| Compound Name | 1-(5-tert-butyl-1,2-oxazol-3-yl)-3-[(6-methyl-4,5,6,7-tetrahydro-1,3-benzothiazol-2-yl)methyl]urea |
|---|---|
| PubChem CID | 166368105 |
| Molecular Formula | C17H24N4O2S |
| Molecular Weight | 348.47 g/mol |
| Exact Mass | 348.16 |
| IUPAC Name | 1-(5-tert-butyl-1,2-oxazol-3-yl)-3-[(6-methyl-4,5,6,7-tetrahydro-1,3-benzothiazol-2-yl)methyl]urea |
| SMILES | CC1CCc2nc(CNC(=O)Nc3cc(C(C)(C)C)on3)sc2C1 |
| InChI | InChI=1S/C17H24N4O2S/c1-10-5-6-11-12(7-10)24-15(19-11)9-18-16(22)20-14-8-13(23-21-14)17(2,3)4/h8,10H,5-7,9H2,1-4H3,(H2,18,20,21,22) |
| InChIKey | RSVOBFLNFHXZHF-UHFFFAOYSA-N |
| XLogP | 3.88 |
| TPSA | 80.05 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 348.47 |
| LogP ≤ 5 | 3.88 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |