C19H28N6O — CID 166370342
1-[4-(2-butan-2-ylpyrimidin-4-yl)piperazin-1-yl]-4-imidazol-1-ylbutan-1-one (PubChem CID 166370342) has the molecular formula C19H28N6O and a molecular weight of 356.47 g/mol. Its IUPAC name is 1-[4-(2-butan-2-ylpyrimidin-4-yl)piperazin-1-yl]-4-imidazol-1-ylbutan-1-one.
| Compound Name | 1-[4-(2-butan-2-ylpyrimidin-4-yl)piperazin-1-yl]-4-imidazol-1-ylbutan-1-one |
|---|---|
| PubChem CID | 166370342 |
| Molecular Formula | C19H28N6O |
| Molecular Weight | 356.47 g/mol |
| Exact Mass | 356.23 |
| IUPAC Name | 1-[4-(2-butan-2-ylpyrimidin-4-yl)piperazin-1-yl]-4-imidazol-1-ylbutan-1-one |
| SMILES | CCC(C)c1nccc(N2CCN(C(=O)CCCn3ccnc3)CC2)n1 |
| InChI | InChI=1S/C19H28N6O/c1-3-16(2)19-21-7-6-17(22-19)24-11-13-25(14-12-24)18(26)5-4-9-23-10-8-20-15-23/h6-8,10,15-16H,3-5,9,11-14H2,1-2H3 |
| InChIKey | JQYXOHYCJJGHSW-UHFFFAOYSA-N |
| XLogP | 2.32 |
| TPSA | 67.15 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 356.47 |
| LogP ≤ 5 | 2.32 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |