C19H22N2OS2 — CID 166370496
N-[2-[1-benzothiophen-2-ylmethyl(methyl)amino]ethyl]-3-thiophen-2-ylpropanamide (PubChem CID 166370496) has the molecular formula C19H22N2OS2 and a molecular weight of 358.53 g/mol. Its IUPAC name is N-[2-[1-benzothiophen-2-ylmethyl(methyl)amino]ethyl]-3-thiophen-2-ylpropanamide.
| Compound Name | N-[2-[1-benzothiophen-2-ylmethyl(methyl)amino]ethyl]-3-thiophen-2-ylpropanamide |
|---|---|
| PubChem CID | 166370496 |
| Molecular Formula | C19H22N2OS2 |
| Molecular Weight | 358.53 g/mol |
| Exact Mass | 358.12 |
| IUPAC Name | N-[2-[1-benzothiophen-2-ylmethyl(methyl)amino]ethyl]-3-thiophen-2-ylpropanamide |
| SMILES | CN(CCNC(=O)CCc1cccs1)Cc1cc2ccccc2s1 |
| InChI | InChI=1S/C19H22N2OS2/c1-21(14-17-13-15-5-2-3-7-18(15)24-17)11-10-20-19(22)9-8-16-6-4-12-23-16/h2-7,12-13H,8-11,14H2,1H3,(H,20,22) |
| InChIKey | IQLZLGCACOVGNL-UHFFFAOYSA-N |
| XLogP | 4.14 |
| TPSA | 32.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 358.53 |
| LogP ≤ 5 | 4.14 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |