C16H22N2O2S2 — CID 166371195
[1-[(3-methyl-1-benzothiophen-2-yl)methyl]piperidin-2-yl]methanesulfonamide (PubChem CID 166371195) has the molecular formula C16H22N2O2S2 and a molecular weight of 338.50 g/mol. Its IUPAC name is [1-[(3-methyl-1-benzothiophen-2-yl)methyl]piperidin-2-yl]methanesulfonamide.
| Compound Name | [1-[(3-methyl-1-benzothiophen-2-yl)methyl]piperidin-2-yl]methanesulfonamide |
|---|---|
| PubChem CID | 166371195 |
| Molecular Formula | C16H22N2O2S2 |
| Molecular Weight | 338.50 g/mol |
| Exact Mass | 338.11 |
| IUPAC Name | [1-[(3-methyl-1-benzothiophen-2-yl)methyl]piperidin-2-yl]methanesulfonamide |
| SMILES | Cc1c(CN2CCCCC2CS(N)(=O)=O)sc2ccccc12 |
| InChI | InChI=1S/C16H22N2O2S2/c1-12-14-7-2-3-8-15(14)21-16(12)10-18-9-5-4-6-13(18)11-22(17,19)20/h2-3,7-8,13H,4-6,9-11H2,1H3,(H2,17,19,20) |
| InChIKey | YOJHPEMCTIZQIH-UHFFFAOYSA-N |
| XLogP | 2.85 |
| TPSA | 63.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 338.50 |
| LogP ≤ 5 | 2.85 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |