C9H15ClN4O2S2 — CID 146121289
[1-[(5-chlorothiadiazol-4-yl)methyl]piperidin-2-yl]methanesulfonamide (PubChem CID 146121289) has the molecular formula C9H15ClN4O2S2 and a molecular weight of 310.83 g/mol. Its IUPAC name is [1-[(5-chlorothiadiazol-4-yl)methyl]piperidin-2-yl]methanesulfonamide.
| Compound Name | [1-[(5-chlorothiadiazol-4-yl)methyl]piperidin-2-yl]methanesulfonamide |
|---|---|
| PubChem CID | 146121289 |
| Molecular Formula | C9H15ClN4O2S2 |
| Molecular Weight | 310.83 g/mol |
| Exact Mass | 310.03 |
| IUPAC Name | [1-[(5-chlorothiadiazol-4-yl)methyl]piperidin-2-yl]methanesulfonamide |
| SMILES | NS(=O)(=O)CC1CCCCN1Cc1nnsc1Cl |
| InChI | InChI=1S/C9H15ClN4O2S2/c10-9-8(12-13-17-9)5-14-4-2-1-3-7(14)6-18(11,15)16/h7H,1-6H2,(H2,11,15,16) |
| InChIKey | ZYCYZXPLHCLYSY-UHFFFAOYSA-N |
| XLogP | 0.83 |
| TPSA | 89.18 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 310.83 |
| LogP ≤ 5 | 0.83 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |