C11H17ClN4S — CID 115824241
4-(1,3,4,6,7,8,9,9a-octahydropyrido[1,2-a]pyrazin-2-ylmethyl)-5-chlorothiadiazole (PubChem CID 115824241) has the molecular formula C11H17ClN4S and a molecular weight of 272.80 g/mol. Its IUPAC name is 4-(1,3,4,6,7,8,9,9a-octahydropyrido[1,2-a]pyrazin-2-ylmethyl)-5-chlorothiadiazole.
| Compound Name | 4-(1,3,4,6,7,8,9,9a-octahydropyrido[1,2-a]pyrazin-2-ylmethyl)-5-chlorothiadiazole |
|---|---|
| PubChem CID | 115824241 |
| Molecular Formula | C11H17ClN4S |
| Molecular Weight | 272.80 g/mol |
| Exact Mass | 272.09 |
| IUPAC Name | 4-(1,3,4,6,7,8,9,9a-octahydropyrido[1,2-a]pyrazin-2-ylmethyl)-5-chlorothiadiazole |
| SMILES | Clc1snnc1CN1CCN2CCCCC2C1 |
| InChI | InChI=1S/C11H17ClN4S/c12-11-10(13-14-17-11)8-15-5-6-16-4-2-1-3-9(16)7-15/h9H,1-8H2 |
| InChIKey | HRXZETDJZPHOEB-UHFFFAOYSA-N |
| XLogP | 1.86 |
| TPSA | 32.26 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 272.80 |
| LogP ≤ 5 | 1.86 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |