C12H19ClN4S — CID 113237768
5-chloro-4-[(3-methyl-1,3,4,6,7,8,9,9a-octahydropyrido[1,2-a]pyrazin-2-yl)methyl]thiadiazole (PubChem CID 113237768) has the molecular formula C12H19ClN4S and a molecular weight of 286.83 g/mol. Its IUPAC name is 5-chloro-4-[(3-methyl-1,3,4,6,7,8,9,9a-octahydropyrido[1,2-a]pyrazin-2-yl)methyl]thiadiazole.
| Compound Name | 5-chloro-4-[(3-methyl-1,3,4,6,7,8,9,9a-octahydropyrido[1,2-a]pyrazin-2-yl)methyl]thiadiazole |
|---|---|
| PubChem CID | 113237768 |
| Molecular Formula | C12H19ClN4S |
| Molecular Weight | 286.83 g/mol |
| Exact Mass | 286.10 |
| IUPAC Name | 5-chloro-4-[(3-methyl-1,3,4,6,7,8,9,9a-octahydropyrido[1,2-a]pyrazin-2-yl)methyl]thiadiazole |
| SMILES | CC1CN2CCCCC2CN1Cc1nnsc1Cl |
| InChI | InChI=1S/C12H19ClN4S/c1-9-6-16-5-3-2-4-10(16)7-17(9)8-11-12(13)18-15-14-11/h9-10H,2-8H2,1H3 |
| InChIKey | NETDVKBSWXVLAA-UHFFFAOYSA-N |
| XLogP | 2.25 |
| TPSA | 32.26 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 286.83 |
| LogP ≤ 5 | 2.25 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |