C11H20N6S — CID 79945518
[4-[(3-methyl-3,4,6,7,8,8a-hexahydro-1H-pyrrolo[1,2-a]pyrazin-2-yl)methyl]thiadiazol-5-yl]hydrazine (PubChem CID 79945518) has the molecular formula C11H20N6S and a molecular weight of 268.39 g/mol. Its IUPAC name is [4-[(3-methyl-3,4,6,7,8,8a-hexahydro-1H-pyrrolo[1,2-a]pyrazin-2-yl)methyl]thiadiazol-5-yl]hydrazine.
| Compound Name | [4-[(3-methyl-3,4,6,7,8,8a-hexahydro-1H-pyrrolo[1,2-a]pyrazin-2-yl)methyl]thiadiazol-5-yl]hydrazine |
|---|---|
| PubChem CID | 79945518 |
| Molecular Formula | C11H20N6S |
| Molecular Weight | 268.39 g/mol |
| Exact Mass | 268.15 |
| IUPAC Name | [4-[(3-methyl-3,4,6,7,8,8a-hexahydro-1H-pyrrolo[1,2-a]pyrazin-2-yl)methyl]thiadiazol-5-yl]hydrazine |
| SMILES | CC1CN2CCCC2CN1Cc1nnsc1NN |
| InChI | InChI=1S/C11H20N6S/c1-8-5-16-4-2-3-9(16)6-17(8)7-10-11(13-12)18-15-14-10/h8-9,13H,2-7,12H2,1H3 |
| InChIKey | JWXVGACLAJRJCL-UHFFFAOYSA-N |
| XLogP | 0.49 |
| TPSA | 70.31 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 268.39 |
| LogP ≤ 5 | 0.49 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|