C14H22ClN5 — CID 79946279
[5-chloro-6-[(3-methyl-3,4,6,7,8,8a-hexahydro-1H-pyrrolo[1,2-a]pyrazin-2-yl)methyl]-2-pyridinyl]hydrazine (PubChem CID 79946279) has the molecular formula C14H22ClN5 and a molecular weight of 295.82 g/mol. Its IUPAC name is [5-chloro-6-[(3-methyl-3,4,6,7,8,8a-hexahydro-1H-pyrrolo[1,2-a]pyrazin-2-yl)methyl]-2-pyridinyl]hydrazine.
| Compound Name | [5-chloro-6-[(3-methyl-3,4,6,7,8,8a-hexahydro-1H-pyrrolo[1,2-a]pyrazin-2-yl)methyl]-2-pyridinyl]hydrazine |
|---|---|
| PubChem CID | 79946279 |
| Molecular Formula | C14H22ClN5 |
| Molecular Weight | 295.82 g/mol |
| Exact Mass | 295.16 |
| IUPAC Name | [5-chloro-6-[(3-methyl-3,4,6,7,8,8a-hexahydro-1H-pyrrolo[1,2-a]pyrazin-2-yl)methyl]-2-pyridinyl]hydrazine |
| SMILES | CC1CN2CCCC2CN1Cc1nc(NN)ccc1Cl |
| InChI | InChI=1S/C14H22ClN5/c1-10-7-19-6-2-3-11(19)8-20(10)9-13-12(15)4-5-14(17-13)18-16/h4-5,10-11H,2-3,6-9,16H2,1H3,(H,17,18) |
| InChIKey | PHAREXZYHRQRAS-UHFFFAOYSA-N |
| XLogP | 1.69 |
| TPSA | 57.42 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 295.82 |
| LogP ≤ 5 | 1.69 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|