C13H21ClN4 — CID 83221611
[5-chloro-6-[(2-ethyl-5-methylpyrrolidin-1-yl)methyl]-2-pyridinyl]hydrazine (PubChem CID 83221611) has the molecular formula C13H21ClN4 and a molecular weight of 268.79 g/mol. Its IUPAC name is [5-chloro-6-[(2-ethyl-5-methylpyrrolidin-1-yl)methyl]-2-pyridinyl]hydrazine.
| Compound Name | [5-chloro-6-[(2-ethyl-5-methylpyrrolidin-1-yl)methyl]-2-pyridinyl]hydrazine |
|---|---|
| PubChem CID | 83221611 |
| Molecular Formula | C13H21ClN4 |
| Molecular Weight | 268.79 g/mol |
| Exact Mass | 268.15 |
| IUPAC Name | [5-chloro-6-[(2-ethyl-5-methylpyrrolidin-1-yl)methyl]-2-pyridinyl]hydrazine |
| SMILES | CCC1CCC(C)N1Cc1nc(NN)ccc1Cl |
| InChI | InChI=1S/C13H21ClN4/c1-3-10-5-4-9(2)18(10)8-12-11(14)6-7-13(16-12)17-15/h6-7,9-10H,3-5,8,15H2,1-2H3,(H,16,17) |
| InChIKey | KUBRANIBCAGMKO-UHFFFAOYSA-N |
| XLogP | 2.78 |
| TPSA | 54.18 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 268.79 |
| LogP ≤ 5 | 2.78 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|