C12H16ClN5S — CID 95343944
5-chloro-4-[[(2R)-2-(pyrazol-1-ylmethyl)piperidin-1-yl]methyl]thiadiazole (PubChem CID 95343944) has the molecular formula C12H16ClN5S and a molecular weight of 297.81 g/mol. Its IUPAC name is 5-chloro-4-[[(2R)-2-(pyrazol-1-ylmethyl)piperidin-1-yl]methyl]thiadiazole.
| Compound Name | 5-chloro-4-[[(2R)-2-(pyrazol-1-ylmethyl)piperidin-1-yl]methyl]thiadiazole |
|---|---|
| PubChem CID | 95343944 |
| Molecular Formula | C12H16ClN5S |
| Molecular Weight | 297.81 g/mol |
| Exact Mass | 297.08 |
| IUPAC Name | 5-chloro-4-[[(2R)-2-(pyrazol-1-ylmethyl)piperidin-1-yl]methyl]thiadiazole |
| SMILES | Clc1snnc1CN1CCCC[C@@H]1Cn1cccn1 |
| InChI | InChI=1S/C12H16ClN5S/c13-12-11(15-16-19-12)9-17-6-2-1-4-10(17)8-18-7-3-5-14-18/h3,5,7,10H,1-2,4,6,8-9H2/t10-/m1/s1 |
| InChIKey | IUIOZBFJGDXQLW-SNVBAGLBSA-N |
| XLogP | 2.44 |
| TPSA | 46.84 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 297.81 |
| LogP ≤ 5 | 2.44 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |