C11H16N4 — CID 95609183
2-[(2S)-2-(pyrazol-1-ylmethyl)piperidin-1-yl]acetonitrile (PubChem CID 95609183) has the molecular formula C11H16N4 and a molecular weight of 204.28 g/mol. Its IUPAC name is 2-[(2S)-2-(pyrazol-1-ylmethyl)piperidin-1-yl]acetonitrile.
| Compound Name | 2-[(2S)-2-(pyrazol-1-ylmethyl)piperidin-1-yl]acetonitrile |
|---|---|
| PubChem CID | 95609183 |
| Molecular Formula | C11H16N4 |
| Molecular Weight | 204.28 g/mol |
| Exact Mass | 204.14 |
| IUPAC Name | 2-[(2S)-2-(pyrazol-1-ylmethyl)piperidin-1-yl]acetonitrile |
| SMILES | N#CCN1CCCC[C@H]1Cn1cccn1 |
| InChI | InChI=1S/C11H16N4/c12-5-9-14-7-2-1-4-11(14)10-15-8-3-6-13-15/h3,6,8,11H,1-2,4,7,9-10H2/t11-/m0/s1 |
| InChIKey | UAODREXDMJLMFM-NSHDSACASA-N |
| XLogP | 1.26 |
| TPSA | 44.85 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 204.28 |
| LogP ≤ 5 | 1.26 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'cyanamide', 'substructure': 'N/A'} |
|---|