C15H20N6O — CID 95326358
N,N-bis(cyanomethyl)-3-[(2S)-2-(pyrazol-1-ylmethyl)pyrrolidin-1-yl]propanamide (PubChem CID 95326358) has the molecular formula C15H20N6O and a molecular weight of 300.37 g/mol. Its IUPAC name is N,N-bis(cyanomethyl)-3-[(2S)-2-(pyrazol-1-ylmethyl)pyrrolidin-1-yl]propanamide.
| Compound Name | N,N-bis(cyanomethyl)-3-[(2S)-2-(pyrazol-1-ylmethyl)pyrrolidin-1-yl]propanamide |
|---|---|
| PubChem CID | 95326358 |
| Molecular Formula | C15H20N6O |
| Molecular Weight | 300.37 g/mol |
| Exact Mass | 300.17 |
| IUPAC Name | N,N-bis(cyanomethyl)-3-[(2S)-2-(pyrazol-1-ylmethyl)pyrrolidin-1-yl]propanamide |
| SMILES | N#CCN(CC#N)C(=O)CCN1CCC[C@H]1Cn1cccn1 |
| InChI | InChI=1S/C15H20N6O/c16-5-11-20(12-6-17)15(22)4-10-19-8-1-3-14(19)13-21-9-2-7-18-21/h2,7,9,14H,1,3-4,8,10-13H2/t14-/m0/s1 |
| InChIKey | QUZYWGLDNMMNTF-AWEZNQCLSA-N |
| XLogP | 0.61 |
| TPSA | 88.95 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 300.37 |
| LogP ≤ 5 | 0.61 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'cyanamide', 'substructure': 'N/A'} |
|---|