C13H21N3 — CID 95325556
(2S)-1-(2-methylprop-2-enyl)-2-(pyrazol-1-ylmethyl)piperidine (PubChem CID 95325556) has the molecular formula C13H21N3 and a molecular weight of 219.33 g/mol. Its IUPAC name is (2S)-1-(2-methylprop-2-enyl)-2-(pyrazol-1-ylmethyl)piperidine.
| Compound Name | (2S)-1-(2-methylprop-2-enyl)-2-(pyrazol-1-ylmethyl)piperidine |
|---|---|
| PubChem CID | 95325556 |
| Molecular Formula | C13H21N3 |
| Molecular Weight | 219.33 g/mol |
| Exact Mass | 219.17 |
| IUPAC Name | (2S)-1-(2-methylprop-2-enyl)-2-(pyrazol-1-ylmethyl)piperidine |
| SMILES | C=C(C)CN1CCCC[C@H]1Cn1cccn1 |
| InChI | InChI=1S/C13H21N3/c1-12(2)10-15-8-4-3-6-13(15)11-16-9-5-7-14-16/h5,7,9,13H,1,3-4,6,8,10-11H2,2H3/t13-/m0/s1 |
| InChIKey | TZRMIDRYQYADHW-ZDUSSCGKSA-N |
| XLogP | 2.31 |
| TPSA | 21.06 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 219.33 |
| LogP ≤ 5 | 2.31 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|