C12H22N4OS — CID 62208088
[1-[[5-(propylamino)thiadiazol-4-yl]methyl]piperidin-2-yl]methanol (PubChem CID 62208088) has the molecular formula C12H22N4OS and a molecular weight of 270.40 g/mol. Its IUPAC name is [1-[[5-(propylamino)thiadiazol-4-yl]methyl]piperidin-2-yl]methanol.
| Compound Name | [1-[[5-(propylamino)thiadiazol-4-yl]methyl]piperidin-2-yl]methanol |
|---|---|
| PubChem CID | 62208088 |
| Molecular Formula | C12H22N4OS |
| Molecular Weight | 270.40 g/mol |
| Exact Mass | 270.15 |
| IUPAC Name | [1-[[5-(propylamino)thiadiazol-4-yl]methyl]piperidin-2-yl]methanol |
| SMILES | CCCNc1snnc1CN1CCCCC1CO |
| InChI | InChI=1S/C12H22N4OS/c1-2-6-13-12-11(14-15-18-12)8-16-7-4-3-5-10(16)9-17/h10,13,17H,2-9H2,1H3 |
| InChIKey | BBOOQAGKJAOLQL-UHFFFAOYSA-N |
| XLogP | 1.71 |
| TPSA | 61.28 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 270.40 |
| LogP ≤ 5 | 1.71 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |