C13H24N4S — CID 83222159
4-[(2-ethyl-5-methylpyrrolidin-1-yl)methyl]-N-propylthiadiazol-5-amine (PubChem CID 83222159) has the molecular formula C13H24N4S and a molecular weight of 268.43 g/mol. Its IUPAC name is 4-[(2-ethyl-5-methylpyrrolidin-1-yl)methyl]-N-propylthiadiazol-5-amine.
| Compound Name | 4-[(2-ethyl-5-methylpyrrolidin-1-yl)methyl]-N-propylthiadiazol-5-amine |
|---|---|
| PubChem CID | 83222159 |
| Molecular Formula | C13H24N4S |
| Molecular Weight | 268.43 g/mol |
| Exact Mass | 268.17 |
| IUPAC Name | 4-[(2-ethyl-5-methylpyrrolidin-1-yl)methyl]-N-propylthiadiazol-5-amine |
| SMILES | CCCNc1snnc1CN1C(C)CCC1CC |
| InChI | InChI=1S/C13H24N4S/c1-4-8-14-13-12(15-16-18-13)9-17-10(3)6-7-11(17)5-2/h10-11,14H,4-9H2,1-3H3 |
| InChIKey | LFAYIDNBGVNRAL-UHFFFAOYSA-N |
| XLogP | 3.12 |
| TPSA | 41.05 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 268.43 |
| LogP ≤ 5 | 3.12 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |