C11H19N5OS — CID 62209676
1-[[5-(ethylamino)thiadiazol-4-yl]methyl]-N-methylpyrrolidine-2-carboxamide (PubChem CID 62209676) has the molecular formula C11H19N5OS and a molecular weight of 269.37 g/mol. Its IUPAC name is 1-[[5-(ethylamino)thiadiazol-4-yl]methyl]-N-methylpyrrolidine-2-carboxamide.
| Compound Name | 1-[[5-(ethylamino)thiadiazol-4-yl]methyl]-N-methylpyrrolidine-2-carboxamide |
|---|---|
| PubChem CID | 62209676 |
| Molecular Formula | C11H19N5OS |
| Molecular Weight | 269.37 g/mol |
| Exact Mass | 269.13 |
| IUPAC Name | 1-[[5-(ethylamino)thiadiazol-4-yl]methyl]-N-methylpyrrolidine-2-carboxamide |
| SMILES | CCNc1snnc1CN1CCCC1C(=O)NC |
| InChI | InChI=1S/C11H19N5OS/c1-3-13-11-8(14-15-18-11)7-16-6-4-5-9(16)10(17)12-2/h9,13H,3-7H2,1-2H3,(H,12,17) |
| InChIKey | MZUYDSWEJMRNNP-UHFFFAOYSA-N |
| XLogP | 0.68 |
| TPSA | 70.15 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 269.37 |
| LogP ≤ 5 | 0.68 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |