2-[methyl(1,6-naphthyridine-5-carbonyl)amino]acetic acid

C12H11N3O3 — CID 166372467

IUPAC2-[methyl(1,6-naphthyridine-5-carbonyl)amino]acetic acid
SMILESCN(CC(=O)O)C(=O)c1nccc2ncccc12
InChIInChI=1S/C12H11N3O3/c1-15(7-10(16)17)12(18)11-8-3-2-5-13-9(8)4-6-14-11/h2-6H,7H2,1H3,(H,16,17)
InChIKeyZVEPACMZCGQNSG-UHFFFAOYSA-N
MW245.24 g/mol
LogP0.79
Rot. Bonds3

About 2-[methyl(1,6-naphthyridine-5-carbonyl)amino]acetic acid

2-[methyl(1,6-naphthyridine-5-carbonyl)amino]acetic acid (PubChem CID 166372467) has the molecular formula C12H11N3O3 and a molecular weight of 245.24 g/mol. Its IUPAC name is 2-[methyl(1,6-naphthyridine-5-carbonyl)amino]acetic acid.

Molecular Properties

Compound Name2-[methyl(1,6-naphthyridine-5-carbonyl)amino]acetic acid
PubChem CID166372467
Molecular FormulaC12H11N3O3
Molecular Weight245.24 g/mol
Exact Mass245.08
IUPAC Name2-[methyl(1,6-naphthyridine-5-carbonyl)amino]acetic acid
SMILESCN(CC(=O)O)C(=O)c1nccc2ncccc12
InChIInChI=1S/C12H11N3O3/c1-15(7-10(16)17)12(18)11-8-3-2-5-13-9(8)4-6-14-11/h2-6H,7H2,1H3,(H,16,17)
InChIKeyZVEPACMZCGQNSG-UHFFFAOYSA-N
XLogP0.79
TPSA83.39 Ų
H-Bond Donors1
H-Bond Acceptors4
Rotatable Bonds3
Heavy Atoms18
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500245.24
LogP ≤ 50.79
H-Bond Donors ≤ 51
H-Bond Acceptors ≤ 104

Analyze 2-[methyl(1,6-naphthyridine-5-carbonyl)amino]acetic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 2-[methyl(1,6-naphthyridine-5-carbonyl)amino]acetic acid?
The IUPAC name of 2-[methyl(1,6-naphthyridine-5-carbonyl)amino]acetic acid (CID 166372467) is 2-[methyl(1,6-naphthyridine-5-carbonyl)amino]acetic acid.
What is the SMILES notation for 2-[methyl(1,6-naphthyridine-5-carbonyl)amino]acetic acid?
The canonical SMILES for 2-[methyl(1,6-naphthyridine-5-carbonyl)amino]acetic acid is CN(CC(=O)O)C(=O)c1nccc2ncccc12.
What is the InChIKey of 2-[methyl(1,6-naphthyridine-5-carbonyl)amino]acetic acid?
The InChIKey is ZVEPACMZCGQNSG-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H11N3O3/c1-15(7-10(16)17)12(18)11-8-3-2-5-13-9(8)4-6-14-11/h2-6H,7H2,1H3,(H,16,17).
What are the key properties of 2-[methyl(1,6-naphthyridine-5-carbonyl)amino]acetic acid?
2-[methyl(1,6-naphthyridine-5-carbonyl)amino]acetic acid has a molecular weight of 245.24 g/mol, XLogP of 0.79, 3 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[methyl(1,6-naphthyridine-5-carbonyl)amino]acetic acid is sourced from PubChem (CID 166372467), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).