C11H12N2O5 — CID 63614269
2-[(2-methoxy-2-oxoethyl)-methylcarbamoyl]pyridine-3-carboxylic acid (PubChem CID 63614269) has the molecular formula C11H12N2O5 and a molecular weight of 252.23 g/mol. Its IUPAC name is 2-[(2-methoxy-2-oxoethyl)-methylcarbamoyl]pyridine-3-carboxylic acid.
| Compound Name | 2-[(2-methoxy-2-oxoethyl)-methylcarbamoyl]pyridine-3-carboxylic acid |
|---|---|
| PubChem CID | 63614269 |
| Molecular Formula | C11H12N2O5 |
| Molecular Weight | 252.23 g/mol |
| Exact Mass | 252.07 |
| IUPAC Name | 2-[(2-methoxy-2-oxoethyl)-methylcarbamoyl]pyridine-3-carboxylic acid |
| SMILES | COC(=O)CN(C)C(=O)c1ncccc1C(=O)O |
| InChI | InChI=1S/C11H12N2O5/c1-13(6-8(14)18-2)10(15)9-7(11(16)17)4-3-5-12-9/h3-5H,6H2,1-2H3,(H,16,17) |
| InChIKey | HNHDYUQLJWPHJN-UHFFFAOYSA-N |
| XLogP | 0.02 |
| TPSA | 96.80 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 252.23 |
| LogP ≤ 5 | 0.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |