C15H26N2O3Si — CID 166375841
N-[(4-hydroxy-1-methylpiperidin-4-yl)methyl]-2-trimethylsilylfuran-3-carboxamide (PubChem CID 166375841) has the molecular formula C15H26N2O3Si and a molecular weight of 310.47 g/mol. Its IUPAC name is N-[(4-hydroxy-1-methylpiperidin-4-yl)methyl]-2-trimethylsilylfuran-3-carboxamide.
| Compound Name | N-[(4-hydroxy-1-methylpiperidin-4-yl)methyl]-2-trimethylsilylfuran-3-carboxamide |
|---|---|
| PubChem CID | 166375841 |
| Molecular Formula | C15H26N2O3Si |
| Molecular Weight | 310.47 g/mol |
| Exact Mass | 310.17 |
| IUPAC Name | N-[(4-hydroxy-1-methylpiperidin-4-yl)methyl]-2-trimethylsilylfuran-3-carboxamide |
| SMILES | CN1CCC(O)(CNC(=O)c2ccoc2[Si](C)(C)C)CC1 |
| InChI | InChI=1S/C15H26N2O3Si/c1-17-8-6-15(19,7-9-17)11-16-13(18)12-5-10-20-14(12)21(2,3)4/h5,10,19H,6-9,11H2,1-4H3,(H,16,18) |
| InChIKey | MHKGQDUHTBVXNM-UHFFFAOYSA-N |
| XLogP | 1.01 |
| TPSA | 65.71 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 310.47 |
| LogP ≤ 5 | 1.01 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|