C18H15FN2O3 — CID 166375965
6-fluoro-N-[2-methyl-3-(methylcarbamoyl)phenyl]-1-benzofuran-2-carboxamide (PubChem CID 166375965) has the molecular formula C18H15FN2O3 and a molecular weight of 326.33 g/mol. Its IUPAC name is 6-fluoro-N-[2-methyl-3-(methylcarbamoyl)phenyl]-1-benzofuran-2-carboxamide.
| Compound Name | 6-fluoro-N-[2-methyl-3-(methylcarbamoyl)phenyl]-1-benzofuran-2-carboxamide |
|---|---|
| PubChem CID | 166375965 |
| Molecular Formula | C18H15FN2O3 |
| Molecular Weight | 326.33 g/mol |
| Exact Mass | 326.11 |
| IUPAC Name | 6-fluoro-N-[2-methyl-3-(methylcarbamoyl)phenyl]-1-benzofuran-2-carboxamide |
| SMILES | CNC(=O)c1cccc(NC(=O)c2cc3ccc(F)cc3o2)c1C |
| InChI | InChI=1S/C18H15FN2O3/c1-10-13(17(22)20-2)4-3-5-14(10)21-18(23)16-8-11-6-7-12(19)9-15(11)24-16/h3-9H,1-2H3,(H,20,22)(H,21,23) |
| InChIKey | IFDLEOIWFKBBHX-UHFFFAOYSA-N |
| XLogP | 3.49 |
| TPSA | 71.34 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 326.33 |
| LogP ≤ 5 | 3.49 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |