C13H15ClN4O — CID 166376059
cis-(1R,2S)-2-[(7-chloropyrido[3,4-b]pyrazin-5-yl)amino]cyclohexan-1-ol (PubChem CID 166376059) has the molecular formula C13H15ClN4O and a molecular weight of 278.74 g/mol. Its IUPAC name is cis-(1R,2S)-2-[(7-chloropyrido[3,4-b]pyrazin-5-yl)amino]cyclohexan-1-ol.
| Compound Name | cis-(1R,2S)-2-[(7-chloropyrido[3,4-b]pyrazin-5-yl)amino]cyclohexan-1-ol |
|---|---|
| PubChem CID | 166376059 |
| Molecular Formula | C13H15ClN4O |
| Molecular Weight | 278.74 g/mol |
| Exact Mass | 278.09 |
| IUPAC Name | cis-(1R,2S)-2-[(7-chloropyrido[3,4-b]pyrazin-5-yl)amino]cyclohexan-1-ol |
| SMILES | O[C@@H]1CCCC[C@@H]1Nc1nc(Cl)cc2nccnc12 |
| InChI | InChI=1S/C13H15ClN4O/c14-11-7-9-12(16-6-5-15-9)13(18-11)17-8-3-1-2-4-10(8)19/h5-8,10,19H,1-4H2,(H,17,18)/t8-,10+/m0/s1 |
| InChIKey | WLQSKPCOYAWDTN-WCBMZHEXSA-N |
| XLogP | 2.39 |
| TPSA | 70.93 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 278.74 |
| LogP ≤ 5 | 2.39 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|