C20H28N4O — CID 166378583
1-(2-methylpropyl)-N'-(4-methylquinolin-2-yl)piperidine-4-carbohydrazide (PubChem CID 166378583) has the molecular formula C20H28N4O and a molecular weight of 340.47 g/mol. Its IUPAC name is 1-(2-methylpropyl)-N'-(4-methylquinolin-2-yl)piperidine-4-carbohydrazide.
| Compound Name | 1-(2-methylpropyl)-N'-(4-methylquinolin-2-yl)piperidine-4-carbohydrazide |
|---|---|
| PubChem CID | 166378583 |
| Molecular Formula | C20H28N4O |
| Molecular Weight | 340.47 g/mol |
| Exact Mass | 340.23 |
| IUPAC Name | 1-(2-methylpropyl)-N'-(4-methylquinolin-2-yl)piperidine-4-carbohydrazide |
| SMILES | Cc1cc(NNC(=O)C2CCN(CC(C)C)CC2)nc2ccccc12 |
| InChI | InChI=1S/C20H28N4O/c1-14(2)13-24-10-8-16(9-11-24)20(25)23-22-19-12-15(3)17-6-4-5-7-18(17)21-19/h4-7,12,14,16H,8-11,13H2,1-3H3,(H,21,22)(H,23,25) |
| InChIKey | BYMWLMABWDCOBU-UHFFFAOYSA-N |
| XLogP | 3.35 |
| TPSA | 57.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 340.47 |
| LogP ≤ 5 | 3.35 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|