C19H23NO4 — CID 16637867
4,16-dimethoxy-10-methyl-10-azatetracyclo[7.7.1.02,7.013,17]heptadeca-2,4,6,13,15-pentaene-5,15-diol (PubChem CID 16637867) has the molecular formula C19H23NO4 and a molecular weight of 329.40 g/mol. Its IUPAC name is 4,16-dimethoxy-10-methyl-10-azatetracyclo[7.7.1.02,7.013,17]heptadeca-2,4,6,13,15-pentaene-5,15-diol.
| Compound Name | 4,16-dimethoxy-10-methyl-10-azatetracyclo[7.7.1.02,7.013,17]heptadeca-2,4,6,13,15-pentaene-5,15-diol |
|---|---|
| PubChem CID | 16637867 |
| Molecular Formula | C19H23NO4 |
| Molecular Weight | 329.40 g/mol |
| Exact Mass | 329.16 |
| IUPAC Name | 4,16-dimethoxy-10-methyl-10-azatetracyclo[7.7.1.02,7.013,17]heptadeca-2,4,6,13,15-pentaene-5,15-diol |
| SMILES | COC1=C(O)C=C2CCN(C)C3Cc4cc(O)c(OC)cc4C1C23 |
| InChI | InChI=1S/C19H23NO4/c1-20-5-4-10-7-15(22)19(24-3)18-12-9-16(23-2)14(21)8-11(12)6-13(20)17(10)18/h7-9,13,17-18,21-22H,4-6H2,1-3H3 |
| InChIKey | JZNAFNXISMTTIY-UHFFFAOYSA-N |
| XLogP | 2.72 |
| TPSA | 62.16 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 329.40 |
| LogP ≤ 5 | 2.72 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |