C20H22O5 — CID 102421887
17-(hydroxymethyl)-5,14-dimethoxytetracyclo[7.7.1.02,7.011,16]heptadeca-2,4,6,11,13,15-hexaene-4,13-diol (PubChem CID 102421887) has the molecular formula C20H22O5 and a molecular weight of 342.39 g/mol. Its IUPAC name is 17-(hydroxymethyl)-5,14-dimethoxytetracyclo[7.7.1.02,7.011,16]heptadeca-2,4,6,11,13,15-hexaene-4,13-diol.
| Compound Name | 17-(hydroxymethyl)-5,14-dimethoxytetracyclo[7.7.1.02,7.011,16]heptadeca-2,4,6,11,13,15-hexaene-4,13-diol |
|---|---|
| PubChem CID | 102421887 |
| Molecular Formula | C20H22O5 |
| Molecular Weight | 342.39 g/mol |
| Exact Mass | 342.15 |
| IUPAC Name | 17-(hydroxymethyl)-5,14-dimethoxytetracyclo[7.7.1.02,7.011,16]heptadeca-2,4,6,11,13,15-hexaene-4,13-diol |
| SMILES | COc1cc2c(cc1O)C1c3cc(OC)c(O)cc3CC(C2)C1CO |
| InChI | InChI=1S/C20H22O5/c1-24-18-6-12-4-10-3-11-5-16(22)19(25-2)8-14(11)20(15(10)9-21)13(12)7-17(18)23/h5-8,10,15,20-23H,3-4,9H2,1-2H3 |
| InChIKey | VHAAKVFDUFFERN-UHFFFAOYSA-N |
| XLogP | 2.58 |
| TPSA | 79.15 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 342.39 |
| LogP ≤ 5 | 2.58 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |