C18H23FN2O3 — CID 166379199
4-fluoro-N-methyl-N-[1-(2-methyloxolane-2-carbonyl)pyrrolidin-3-yl]benzamide (PubChem CID 166379199) has the molecular formula C18H23FN2O3 and a molecular weight of 334.39 g/mol. Its IUPAC name is 4-fluoro-N-methyl-N-[1-(2-methyloxolane-2-carbonyl)pyrrolidin-3-yl]benzamide.
| Compound Name | 4-fluoro-N-methyl-N-[1-(2-methyloxolane-2-carbonyl)pyrrolidin-3-yl]benzamide |
|---|---|
| PubChem CID | 166379199 |
| Molecular Formula | C18H23FN2O3 |
| Molecular Weight | 334.39 g/mol |
| Exact Mass | 334.17 |
| IUPAC Name | 4-fluoro-N-methyl-N-[1-(2-methyloxolane-2-carbonyl)pyrrolidin-3-yl]benzamide |
| SMILES | CN(C(=O)c1ccc(F)cc1)C1CCN(C(=O)C2(C)CCCO2)C1 |
| InChI | InChI=1S/C18H23FN2O3/c1-18(9-3-11-24-18)17(23)21-10-8-15(12-21)20(2)16(22)13-4-6-14(19)7-5-13/h4-7,15H,3,8-12H2,1-2H3 |
| InChIKey | RAAUPJLSTJDCQD-UHFFFAOYSA-N |
| XLogP | 2.07 |
| TPSA | 49.85 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 334.39 |
| LogP ≤ 5 | 2.07 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |