C17H22Cl2N2O3 — CID 166381429
1-[4-(2,4-dichlorophenyl)piperazin-1-yl]-2-(3-hydroxyoxan-3-yl)ethanone (PubChem CID 166381429) has the molecular formula C17H22Cl2N2O3 and a molecular weight of 373.28 g/mol. Its IUPAC name is 1-[4-(2,4-dichlorophenyl)piperazin-1-yl]-2-(3-hydroxyoxan-3-yl)ethanone.
| Compound Name | 1-[4-(2,4-dichlorophenyl)piperazin-1-yl]-2-(3-hydroxyoxan-3-yl)ethanone |
|---|---|
| PubChem CID | 166381429 |
| Molecular Formula | C17H22Cl2N2O3 |
| Molecular Weight | 373.28 g/mol |
| Exact Mass | 372.10 |
| IUPAC Name | 1-[4-(2,4-dichlorophenyl)piperazin-1-yl]-2-(3-hydroxyoxan-3-yl)ethanone |
| SMILES | O=C(CC1(O)CCCOC1)N1CCN(c2ccc(Cl)cc2Cl)CC1 |
| InChI | InChI=1S/C17H22Cl2N2O3/c18-13-2-3-15(14(19)10-13)20-5-7-21(8-6-20)16(22)11-17(23)4-1-9-24-12-17/h2-3,10,23H,1,4-9,11-12H2 |
| InChIKey | GYPOSIMQRJOXRM-UHFFFAOYSA-N |
| XLogP | 2.57 |
| TPSA | 53.01 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 373.28 |
| LogP ≤ 5 | 2.57 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |